C20H16N4O3 — CID 164629097
N-[3-[5-(3,4-dihydroxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]phenyl]acetamide (PubChem CID 164629097) has the molecular formula C20H16N4O3 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[3-[5-(3,4-dihydroxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-(3,4-dihydroxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 164629097 |
| Molecular Formula | C20H16N4O3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | N-[3-[5-(3,4-dihydroxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2[nH]nc3ncc(-c4ccc(O)c(O)c4)cc23)c1 |
| InChI | InChI=1S/C20H16N4O3/c1-11(25)22-15-4-2-3-13(7-15)19-16-8-14(10-21-20(16)24-23-19)12-5-6-17(26)18(27)9-12/h2-10,26-27H,1H3,(H,22,25)(H,21,23,24) |
| InChIKey | LEHDQJMFXABVJA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|