About 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline
4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline (PubChem CID 164629098) has the molecular formula C15H16BNO2
and a molecular weight of 253.11 g/mol. Its IUPAC name is 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline |
| PubChem CID | 164629098 |
| Molecular Formula | C15H16BNO2 |
| Molecular Weight | 253.11 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2OB(O)c3ccccc32)cc1 |
| InChI | InChI=1S/C15H16BNO2/c1-17(2)12-9-7-11(8-10-12)15-13-5-3-4-6-14(13)16(18)19-15/h3-10,15,18H,1-2H3 |
| InChIKey | FGWIPVZZFGHNIN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.11 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline?
The IUPAC name of 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline (CID 164629098) is 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline?
The canonical SMILES for 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline is CN(C)c1ccc(C2OB(O)c3ccccc32)cc1.
What is the InChIKey of 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline?
The InChIKey is FGWIPVZZFGHNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BNO2/c1-17(2)12-9-7-11(8-10-12)15-13-5-3-4-6-14(13)16(18)19-15/h3-10,15,18H,1-2H3.
What are the key properties of 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline?
4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline has a molecular weight of 253.11 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)-N,N-dimethylaniline is sourced from PubChem (CID 164629098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).