About trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine
trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine (PubChem CID 164629161) has the molecular formula C20H22N4O2
and a molecular weight of 350.42 g/mol. Its IUPAC name is trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine.
Molecular Properties
| Compound Name | trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine |
| PubChem CID | 164629161 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine |
| SMILES | COc1cc(OC)cc(-n2cc(CN[C@@H]3C[C@H]3c3ccccc3)nn2)c1 |
| InChI | InChI=1S/C20H22N4O2/c1-25-17-8-16(9-18(10-17)26-2)24-13-15(22-23-24)12-21-20-11-19(20)14-6-4-3-5-7-14/h3-10,13,19-21H,11-12H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | BJBAMZGCZXFTGT-VQTJNVASSA-N |
| XLogP | 2.93 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine?
The IUPAC name of trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine (CID 164629161) is trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine.
What is the SMILES notation for trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine?
The canonical SMILES for trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine is COc1cc(OC)cc(-n2cc(CN[C@@H]3C[C@H]3c3ccccc3)nn2)c1.
What is the InChIKey of trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine?
The InChIKey is BJBAMZGCZXFTGT-VQTJNVASSA-N. The full InChI is InChI=1S/C20H22N4O2/c1-25-17-8-16(9-18(10-17)26-2)24-13-15(22-23-24)12-21-20-11-19(20)14-6-4-3-5-7-14/h3-10,13,19-21H,11-12H2,1-2H3/t19-,20+/m0/s1.
What are the key properties of trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine?
trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine has a molecular weight of 350.42 g/mol, XLogP of 2.93, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-N-[[1-(3,5-dimethoxyphenyl)triazol-4-yl]methyl]-2-phenylcyclopropan-1-amine is sourced from PubChem (CID 164629161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).