About (5,8-dioxonaphthalen-2-yl) methanesulfonate
(5,8-dioxonaphthalen-2-yl) methanesulfonate (PubChem CID 164629170) has the molecular formula C11H8O5S
and a molecular weight of 252.25 g/mol. Its IUPAC name is (5,8-dioxonaphthalen-2-yl) methanesulfonate.
Molecular Properties
| Compound Name | (5,8-dioxonaphthalen-2-yl) methanesulfonate |
| PubChem CID | 164629170 |
| Molecular Formula | C11H8O5S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (5,8-dioxonaphthalen-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)C(=O)C=CC2=O |
| InChI | InChI=1S/C11H8O5S/c1-17(14,15)16-7-2-3-8-9(6-7)11(13)5-4-10(8)12/h2-6H,1H3 |
| InChIKey | UPFUAUGJZNDPCP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5,8-dioxonaphthalen-2-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,8-dioxonaphthalen-2-yl) methanesulfonate?
The IUPAC name of (5,8-dioxonaphthalen-2-yl) methanesulfonate (CID 164629170) is (5,8-dioxonaphthalen-2-yl) methanesulfonate.
What is the SMILES notation for (5,8-dioxonaphthalen-2-yl) methanesulfonate?
The canonical SMILES for (5,8-dioxonaphthalen-2-yl) methanesulfonate is CS(=O)(=O)Oc1ccc2c(c1)C(=O)C=CC2=O.
What is the InChIKey of (5,8-dioxonaphthalen-2-yl) methanesulfonate?
The InChIKey is UPFUAUGJZNDPCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O5S/c1-17(14,15)16-7-2-3-8-9(6-7)11(13)5-4-10(8)12/h2-6H,1H3.
What are the key properties of (5,8-dioxonaphthalen-2-yl) methanesulfonate?
(5,8-dioxonaphthalen-2-yl) methanesulfonate has a molecular weight of 252.25 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,8-dioxonaphthalen-2-yl) methanesulfonate is sourced from PubChem (CID 164629170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).