C20H34FO2P — CID 164629208
fluoro-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]phosphinic acid (PubChem CID 164629208) has the molecular formula C20H34FO2P and a molecular weight of 356.46 g/mol. Its IUPAC name is fluoro-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]phosphinic acid.
| Compound Name | fluoro-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]phosphinic acid |
|---|---|
| PubChem CID | 164629208 |
| Molecular Formula | C20H34FO2P |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | fluoro-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]phosphinic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCP(=O)(O)F |
| InChI | InChI=1S/C20H34FO2P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(21,22)23/h6-7,9-10,12-13,15-16H,2-5,8,11,14,17-20H2,1H3,(H,22,23)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | SSHNISHEMOJODV-DOFZRALJSA-N |
| XLogP | 7.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|