About N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine
N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine (PubChem CID 164629226) has the molecular formula C28H27N5S
and a molecular weight of 465.63 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine |
| PubChem CID | 164629226 |
| Molecular Formula | C28H27N5S |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncc4scc(-c5ccc6ccccc6c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H27N5S/c1-2-32-13-15-33(16-14-32)24-11-9-23(10-12-24)30-28-29-18-26-27(31-28)25(19-34-26)22-8-7-20-5-3-4-6-21(20)17-22/h3-12,17-19H,2,13-16H2,1H3,(H,29,30,31) |
| InChIKey | MECCZDJAXPDMTC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine?
The IUPAC name of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine (CID 164629226) is N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine?
The canonical SMILES for N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine is CCN1CCN(c2ccc(Nc3ncc4scc(-c5ccc6ccccc6c5)c4n3)cc2)CC1.
What is the InChIKey of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine?
The InChIKey is MECCZDJAXPDMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N5S/c1-2-32-13-15-33(16-14-32)24-11-9-23(10-12-24)30-28-29-18-26-27(31-28)25(19-34-26)22-8-7-20-5-3-4-6-21(20)17-22/h3-12,17-19H,2,13-16H2,1H3,(H,29,30,31).
What are the key properties of N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine?
N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine has a molecular weight of 465.63 g/mol, XLogP of 6.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-naphthalen-2-ylthieno[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 164629226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).