C18H24N4O — CID 164629347
(1S,2S,4S)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 164629347) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is (1S,2S,4S)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 164629347 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (1S,2S,4S)-N-[2-(6-pyrrolidin-1-ylpyrimidin-4-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(NCCc1cc(N2CCCC2)ncn1)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C18H24N4O/c23-18(16-10-13-3-4-14(16)9-13)19-6-5-15-11-17(21-12-20-15)22-7-1-2-8-22/h3-4,11-14,16H,1-2,5-10H2,(H,19,23)/t13-,14+,16-/m0/s1 |
| InChIKey | IRDKGIFYYAHCAP-LZWOXQAQSA-N |
| XLogP | 1.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|