About (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide
(3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide (PubChem CID 164629369) has the molecular formula C14H18ClNO4S2
and a molecular weight of 363.89 g/mol. Its IUPAC name is (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide.
Molecular Properties
| Compound Name | (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide |
| PubChem CID | 164629369 |
| Molecular Formula | C14H18ClNO4S2 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCC[C@H](CS(=O)(=O)N2CCc3cc(Cl)ccc32)C1 |
| InChI | InChI=1S/C14H18ClNO4S2/c15-13-3-4-14-12(8-13)5-6-16(14)22(19,20)10-11-2-1-7-21(17,18)9-11/h3-4,8,11H,1-2,5-7,9-10H2/t11-/m0/s1 |
| InChIKey | OPIADYIKDNTGQO-NSHDSACASA-N |
| XLogP | 1.86 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide?
The IUPAC name of (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide (CID 164629369) is (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide.
What is the SMILES notation for (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide?
The canonical SMILES for (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide is O=S1(=O)CCC[C@H](CS(=O)(=O)N2CCc3cc(Cl)ccc32)C1.
What is the InChIKey of (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide?
The InChIKey is OPIADYIKDNTGQO-NSHDSACASA-N. The full InChI is InChI=1S/C14H18ClNO4S2/c15-13-3-4-14-12(8-13)5-6-16(14)22(19,20)10-11-2-1-7-21(17,18)9-11/h3-4,8,11H,1-2,5-7,9-10H2/t11-/m0/s1.
What are the key properties of (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide?
(3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide has a molecular weight of 363.89 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonylmethyl]thiane 1,1-dioxide is sourced from PubChem (CID 164629369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).