C15H19N3O3 — CID 164629431
N-[(3S)-1-methyl-2,6-dioxopiperidin-3-yl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide (PubChem CID 164629431) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-[(3S)-1-methyl-2,6-dioxopiperidin-3-yl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide.
| Compound Name | N-[(3S)-1-methyl-2,6-dioxopiperidin-3-yl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164629431 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-[(3S)-1-methyl-2,6-dioxopiperidin-3-yl]-4,5,6,7-tetrahydro-1H-indole-2-carboxamide |
| SMILES | CN1C(=O)CC[C@H](NC(=O)c2cc3c([nH]2)CCCC3)C1=O |
| InChI | InChI=1S/C15H19N3O3/c1-18-13(19)7-6-11(15(18)21)17-14(20)12-8-9-4-2-3-5-10(9)16-12/h8,11,16H,2-7H2,1H3,(H,17,20)/t11-/m0/s1 |
| InChIKey | ZGDISXRZNUZHAB-NSHDSACASA-N |
| XLogP | 0.77 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|