About 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride
4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride (PubChem CID 164629447) has the molecular formula C17H20FN3O4S
and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride |
| PubChem CID | 164629447 |
| Molecular Formula | C17H20FN3O4S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride |
| SMILES | CC(C)n1nccc1[C@H]1OCC[C@@H]1NC(=O)c1ccc(S(=O)(=O)F)cc1 |
| InChI | InChI=1S/C17H20FN3O4S/c1-11(2)21-15(7-9-19-21)16-14(8-10-25-16)20-17(22)12-3-5-13(6-4-12)26(18,23)24/h3-7,9,11,14,16H,8,10H2,1-2H3,(H,20,22)/t14-,16-/m0/s1 |
| InChIKey | CAFVNURYXBWBPR-HOCLYGCPSA-N |
| XLogP | 2.38 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride?
The IUPAC name of 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride (CID 164629447) is 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride.
What is the SMILES notation for 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride?
The canonical SMILES for 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride is CC(C)n1nccc1[C@H]1OCC[C@@H]1NC(=O)c1ccc(S(=O)(=O)F)cc1.
What is the InChIKey of 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride?
The InChIKey is CAFVNURYXBWBPR-HOCLYGCPSA-N. The full InChI is InChI=1S/C17H20FN3O4S/c1-11(2)21-15(7-9-19-21)16-14(8-10-25-16)20-17(22)12-3-5-13(6-4-12)26(18,23)24/h3-7,9,11,14,16H,8,10H2,1-2H3,(H,20,22)/t14-,16-/m0/s1.
What are the key properties of 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride?
4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride has a molecular weight of 381.43 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S,3S)-2-(2-propan-2-ylpyrazol-3-yl)oxolan-3-yl]carbamoyl]benzenesulfonyl fluoride is sourced from PubChem (CID 164629447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).