C16H22N2OS — CID 164629559
(1S,2S,4S)-N-[(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 164629559) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (1S,2S,4S)-N-[(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,4S)-N-[(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 164629559 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1S,2S,4S)-N-[(4-methyl-2-propan-2-yl-1,3-thiazol-5-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1nc(C(C)C)sc1CNC(=O)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H22N2OS/c1-9(2)16-18-10(3)14(20-16)8-17-15(19)13-7-11-4-5-12(13)6-11/h4-5,9,11-13H,6-8H2,1-3H3,(H,17,19)/t11-,12+,13-/m0/s1 |
| InChIKey | RULNZMOAZPXSSO-XQQFMLRXSA-N |
| XLogP | 3.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|