About (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide
(4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide (PubChem CID 164629686) has the molecular formula C8H10N4O2S
and a molecular weight of 226.26 g/mol. Its IUPAC name is (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide.
Molecular Properties
| Compound Name | (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide |
| PubChem CID | 164629686 |
| Molecular Formula | C8H10N4O2S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)[C@@H]2CNC(=O)N2)s1 |
| InChI | InChI=1S/C8H10N4O2S/c1-4-2-10-8(15-4)12-6(13)5-3-9-7(14)11-5/h2,5H,3H2,1H3,(H2,9,11,14)(H,10,12,13)/t5-/m0/s1 |
| InChIKey | XJDHNLOKTURNSX-YFKPBYRVSA-N |
| XLogP | 0.07 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide?
The IUPAC name of (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide (CID 164629686) is (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide.
What is the SMILES notation for (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide?
The canonical SMILES for (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide is Cc1cnc(NC(=O)[C@@H]2CNC(=O)N2)s1.
What is the InChIKey of (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide?
The InChIKey is XJDHNLOKTURNSX-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H10N4O2S/c1-4-2-10-8(15-4)12-6(13)5-3-9-7(14)11-5/h2,5H,3H2,1H3,(H2,9,11,14)(H,10,12,13)/t5-/m0/s1.
What are the key properties of (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide?
(4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide has a molecular weight of 226.26 g/mol, XLogP of 0.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N-(5-methyl-1,3-thiazol-2-yl)-2-oxoimidazolidine-4-carboxamide is sourced from PubChem (CID 164629686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).