About 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide
4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide (PubChem CID 164629816) has the molecular formula C16H17N3O3
and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide |
| PubChem CID | 164629816 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide |
| SMILES | C[C@@]1(C(=O)Nc2c[nH]c(C(N)=O)c2)CCOc2ccccc21 |
| InChI | InChI=1S/C16H17N3O3/c1-16(6-7-22-13-5-3-2-4-11(13)16)15(21)19-10-8-12(14(17)20)18-9-10/h2-5,8-9,18H,6-7H2,1H3,(H2,17,20)(H,19,21)/t16-/m1/s1 |
| InChIKey | JAWMLKYYGZFJTO-MRXNPFEDSA-N |
| XLogP | 1.79 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide?
The IUPAC name of 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide (CID 164629816) is 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide is C[C@@]1(C(=O)Nc2c[nH]c(C(N)=O)c2)CCOc2ccccc21.
What is the InChIKey of 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide?
The InChIKey is JAWMLKYYGZFJTO-MRXNPFEDSA-N. The full InChI is InChI=1S/C16H17N3O3/c1-16(6-7-22-13-5-3-2-4-11(13)16)15(21)19-10-8-12(14(17)20)18-9-10/h2-5,8-9,18H,6-7H2,1H3,(H2,17,20)(H,19,21)/t16-/m1/s1.
What are the key properties of 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide?
4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide has a molecular weight of 299.33 g/mol, XLogP of 1.79, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4R)-4-methyl-2,3-dihydrochromene-4-carbonyl]amino]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 164629816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).