C13H17F3N2O2 — CID 164629912
N-[(1S)-1-(1-methoxycyclobutyl)ethyl]-5-(trifluoromethyl)-1H-pyrrole-3-carboxamide (PubChem CID 164629912) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is N-[(1S)-1-(1-methoxycyclobutyl)ethyl]-5-(trifluoromethyl)-1H-pyrrole-3-carboxamide.
| Compound Name | N-[(1S)-1-(1-methoxycyclobutyl)ethyl]-5-(trifluoromethyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 164629912 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-[(1S)-1-(1-methoxycyclobutyl)ethyl]-5-(trifluoromethyl)-1H-pyrrole-3-carboxamide |
| SMILES | COC1([C@H](C)NC(=O)c2c[nH]c(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C13H17F3N2O2/c1-8(12(20-2)4-3-5-12)18-11(19)9-6-10(17-7-9)13(14,15)16/h6-8,17H,3-5H2,1-2H3,(H,18,19)/t8-/m0/s1 |
| InChIKey | FYSBYTLHYHJROA-QMMMGPOBSA-N |
| XLogP | 2.72 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |