C16H23N3O2S — CID 164629962
3-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 164629962) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 164629962 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CCc1nc([C@H](C)N2C(=O)N(C)C3(CCCCC3)C2=O)cs1 |
| InChI | InChI=1S/C16H23N3O2S/c1-4-13-17-12(10-22-13)11(2)19-14(20)16(18(3)15(19)21)8-6-5-7-9-16/h10-11H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | SSAHOJZBZGGNRM-NSHDSACASA-N |
| XLogP | 3.36 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|