About 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea
1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea (PubChem CID 164629970) has the molecular formula C16H24N4O
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea |
| PubChem CID | 164629970 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea |
| SMILES | O=C(NCc1ncccn1)NC[C@H]1C[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C16H24N4O/c21-16(20-11-15-17-7-4-8-18-15)19-10-13-9-14(13)12-5-2-1-3-6-12/h4,7-8,12-14H,1-3,5-6,9-11H2,(H2,19,20,21)/t13-,14-/m1/s1 |
| InChIKey | SEHDNLYPEPBUAI-ZIAGYGMSSA-N |
| XLogP | 2.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea?
The IUPAC name of 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea (CID 164629970) is 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea.
What is the SMILES notation for 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea?
The canonical SMILES for 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea is O=C(NCc1ncccn1)NC[C@H]1C[C@@H]1C1CCCCC1.
What is the InChIKey of 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea?
The InChIKey is SEHDNLYPEPBUAI-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H24N4O/c21-16(20-11-15-17-7-4-8-18-15)19-10-13-9-14(13)12-5-2-1-3-6-12/h4,7-8,12-14H,1-3,5-6,9-11H2,(H2,19,20,21)/t13-,14-/m1/s1.
What are the key properties of 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea?
1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea has a molecular weight of 288.39 g/mol, XLogP of 2.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,2R)-2-cyclohexylcyclopropyl]methyl]-3-(pyrimidin-2-ylmethyl)urea is sourced from PubChem (CID 164629970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).