C17H23N5O2S — CID 164630188
(4aS,7aR)-1-benzyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 164630188) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is (4aS,7aR)-1-benzyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-benzyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 164630188 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (4aS,7aR)-1-benzyl-4-[(4-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | Cn1cnnc1CN1CCN(Cc2ccccc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H23N5O2S/c1-20-13-18-19-17(20)10-22-8-7-21(9-14-5-3-2-4-6-14)15-11-25(23,24)12-16(15)22/h2-6,13,15-16H,7-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | ZNGYRXUJKQQPPD-JKSUJKDBSA-N |
| XLogP | 0.30 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |