C17H20N4O2S — CID 164630251
(5R)-5-(4-tert-butylphenyl)-5-methyl-3-(1,3,4-thiadiazol-2-ylmethyl)imidazolidine-2,4-dione (PubChem CID 164630251) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is (5R)-5-(4-tert-butylphenyl)-5-methyl-3-(1,3,4-thiadiazol-2-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-tert-butylphenyl)-5-methyl-3-(1,3,4-thiadiazol-2-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164630251 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (5R)-5-(4-tert-butylphenyl)-5-methyl-3-(1,3,4-thiadiazol-2-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc([C@@]2(C)NC(=O)N(Cc3nncs3)C2=O)cc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-16(2,3)11-5-7-12(8-6-11)17(4)14(22)21(15(23)19-17)9-13-20-18-10-24-13/h5-8,10H,9H2,1-4H3,(H,19,23)/t17-/m1/s1 |
| InChIKey | WLXRXYTWWUBTRO-QGZVFWFLSA-N |
| XLogP | 2.80 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|