C14H16N4 — CID 164630320
5-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]pyrimidine-2,4-diamine (PubChem CID 164630320) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164630320 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-methyl-4-N-[(1S,2R)-2-phenylcyclopropyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(N)nc1N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H16N4/c1-9-8-16-14(15)18-13(9)17-12-7-11(12)10-5-3-2-4-6-10/h2-6,8,11-12H,7H2,1H3,(H3,15,16,17,18)/t11-,12+/m1/s1 |
| InChIKey | WDGHXXDVYPCGKF-NEPJUHHUSA-N |
| XLogP | 2.34 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |