C14H21N3O2S — CID 164630396
1-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-1-methyl-3-(1,3-thiazol-2-ylmethyl)urea (PubChem CID 164630396) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-1-methyl-3-(1,3-thiazol-2-ylmethyl)urea.
| Compound Name | 1-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-1-methyl-3-(1,3-thiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 164630396 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[[(3aS,6aS)-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3a-yl]methyl]-1-methyl-3-(1,3-thiazol-2-ylmethyl)urea |
| SMILES | CN(C[C@@]12CCC[C@@H]1OCC2)C(=O)NCc1nccs1 |
| InChI | InChI=1S/C14H21N3O2S/c1-17(13(18)16-9-12-15-6-8-20-12)10-14-4-2-3-11(14)19-7-5-14/h6,8,11H,2-5,7,9-10H2,1H3,(H,16,18)/t11-,14-/m0/s1 |
| InChIKey | KVBORDJRMABDHZ-FZMZJTMJSA-N |
| XLogP | 2.24 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |