C15H22F2N4O3 — CID 164630420
tert-butyl 2-[[(5S,7S)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]acetate (PubChem CID 164630420) has the molecular formula C15H22F2N4O3 and a molecular weight of 344.36 g/mol. Its IUPAC name is tert-butyl 2-[[(5S,7S)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(5S,7S)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 164630420 |
| Molecular Formula | C15H22F2N4O3 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | tert-butyl 2-[[(5S,7S)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]acetate |
| SMILES | C[C@H]1C[C@@H](C(F)F)n2ncc(C(=O)NCC(=O)OC(C)(C)C)c2N1 |
| InChI | InChI=1S/C15H22F2N4O3/c1-8-5-10(12(16)17)21-13(20-8)9(6-19-21)14(23)18-7-11(22)24-15(2,3)4/h6,8,10,12,20H,5,7H2,1-4H3,(H,18,23)/t8-,10-/m0/s1 |
| InChIKey | HBKVAHUUKQLVER-WPRPVWTQSA-N |
| XLogP | 1.96 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |