C15H21N3O2 — CID 164630500
(1R)-1-(5-butyl-1H-1,2,4-triazol-3-yl)-2-(2-methylphenoxy)ethanol (PubChem CID 164630500) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1R)-1-(5-butyl-1H-1,2,4-triazol-3-yl)-2-(2-methylphenoxy)ethanol.
| Compound Name | (1R)-1-(5-butyl-1H-1,2,4-triazol-3-yl)-2-(2-methylphenoxy)ethanol |
|---|---|
| PubChem CID | 164630500 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | (1R)-1-(5-butyl-1H-1,2,4-triazol-3-yl)-2-(2-methylphenoxy)ethanol |
| SMILES | CCCCc1nc([C@@H](O)COc2ccccc2C)n[nH]1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-4-9-14-16-15(18-17-14)12(19)10-20-13-8-6-5-7-11(13)2/h5-8,12,19H,3-4,9-10H2,1-2H3,(H,16,17,18)/t12-/m0/s1 |
| InChIKey | KSLGYIMOIFJXLV-LBPRGKRZSA-N |
| XLogP | 2.57 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |