About methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate
methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 164630732) has the molecular formula C16H24N2O5
and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate |
| PubChem CID | 164630732 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](CC(C)C)C(=O)Nc1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C16H24N2O5/c1-10(2)6-14(18-16(22)23-3)15(21)17-13-5-4-11(8-19)12(7-13)9-20/h4-5,7,10,14,19-20H,6,8-9H2,1-3H3,(H,17,21)(H,18,22)/t14-/m0/s1 |
| InChIKey | PIXDHEZOVILIMC-AWEZNQCLSA-N |
| XLogP | 1.38 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate?
The IUPAC name of methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate (CID 164630732) is methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate.
What is the SMILES notation for methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate?
The canonical SMILES for methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate is COC(=O)N[C@@H](CC(C)C)C(=O)Nc1ccc(CO)c(CO)c1.
What is the InChIKey of methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate?
The InChIKey is PIXDHEZOVILIMC-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H24N2O5/c1-10(2)6-14(18-16(22)23-3)15(21)17-13-5-4-11(8-19)12(7-13)9-20/h4-5,7,10,14,19-20H,6,8-9H2,1-3H3,(H,17,21)(H,18,22)/t14-/m0/s1.
What are the key properties of methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate?
methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate has a molecular weight of 324.38 g/mol, XLogP of 1.38, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2S)-1-[3,4-bis(hydroxymethyl)anilino]-4-methyl-1-oxopentan-2-yl]carbamate is sourced from PubChem (CID 164630732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).