About 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole
5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole (PubChem CID 164630742) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole |
| PubChem CID | 164630742 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole |
| SMILES | CO[C@H]1CCN(Cc2sc(C)nc2C)C1 |
| InChI | InChI=1S/C11H18N2OS/c1-8-11(15-9(2)12-8)7-13-5-4-10(6-13)14-3/h10H,4-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | VTQJWDLOFMGFAL-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole?
The IUPAC name of 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole (CID 164630742) is 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole.
What is the SMILES notation for 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole?
The canonical SMILES for 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole is CO[C@H]1CCN(Cc2sc(C)nc2C)C1.
What is the InChIKey of 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole?
The InChIKey is VTQJWDLOFMGFAL-JTQLQIEISA-N. The full InChI is InChI=1S/C11H18N2OS/c1-8-11(15-9(2)12-8)7-13-5-4-10(6-13)14-3/h10H,4-7H2,1-3H3/t10-/m0/s1.
What are the key properties of 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole?
5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole has a molecular weight of 226.34 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3S)-3-methoxypyrrolidin-1-yl]methyl]-2,4-dimethyl-1,3-thiazole is sourced from PubChem (CID 164630742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).