C21H27N3O2 — CID 164630757
1-[(1S,3R)-3-cyclopropylcyclohexyl]-3-[1-(1,3-oxazol-2-yl)-2-phenylethyl]urea (PubChem CID 164630757) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(1S,3R)-3-cyclopropylcyclohexyl]-3-[1-(1,3-oxazol-2-yl)-2-phenylethyl]urea.
| Compound Name | 1-[(1S,3R)-3-cyclopropylcyclohexyl]-3-[1-(1,3-oxazol-2-yl)-2-phenylethyl]urea |
|---|---|
| PubChem CID | 164630757 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(1S,3R)-3-cyclopropylcyclohexyl]-3-[1-(1,3-oxazol-2-yl)-2-phenylethyl]urea |
| SMILES | O=C(NC(Cc1ccccc1)c1ncco1)N[C@H]1CCC[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C21H27N3O2/c25-21(23-18-8-4-7-17(14-18)16-9-10-16)24-19(20-22-11-12-26-20)13-15-5-2-1-3-6-15/h1-3,5-6,11-12,16-19H,4,7-10,13-14H2,(H2,23,24,25)/t17-,18+,19?/m1/s1 |
| InChIKey | SNUBXADCEKLBES-YTYFACEESA-N |
| XLogP | 4.23 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |