About 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid
5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid (PubChem CID 164630855) has the molecular formula C12H15F2NO2S
and a molecular weight of 275.32 g/mol. Its IUPAC name is 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid |
| PubChem CID | 164630855 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid |
| SMILES | C[C@H]1CC(F)(F)CCN1Cc1cc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H15F2NO2S/c1-8-5-12(13,14)2-3-15(8)6-10-4-9(7-18-10)11(16)17/h4,7-8H,2-3,5-6H2,1H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | HVGHXBTXCSLLHF-QMMMGPOBSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid?
The IUPAC name of 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid (CID 164630855) is 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid.
What is the SMILES notation for 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid?
The canonical SMILES for 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid is C[C@H]1CC(F)(F)CCN1Cc1cc(C(=O)O)cs1.
What is the InChIKey of 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid?
The InChIKey is HVGHXBTXCSLLHF-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H15F2NO2S/c1-8-5-12(13,14)2-3-15(8)6-10-4-9(7-18-10)11(16)17/h4,7-8H,2-3,5-6H2,1H3,(H,16,17)/t8-/m0/s1.
What are the key properties of 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid?
5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid has a molecular weight of 275.32 g/mol, XLogP of 3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2S)-4,4-difluoro-2-methylpiperidin-1-yl]methyl]thiophene-3-carboxylic acid is sourced from PubChem (CID 164630855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).