About N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide
N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide (PubChem CID 164630900) has the molecular formula C16H18N2O2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide |
| PubChem CID | 164630900 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide |
| SMILES | CN(C[C@@H]1OCCc2ccccc21)C(=O)Cc1cscn1 |
| InChI | InChI=1S/C16H18N2O2S/c1-18(16(19)8-13-10-21-11-17-13)9-15-14-5-3-2-4-12(14)6-7-20-15/h2-5,10-11,15H,6-9H2,1H3/t15-/m0/s1 |
| InChIKey | RYNCOGZQPHRLNI-HNNXBMFYSA-N |
| XLogP | 2.46 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide (CID 164630900) is N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide is CN(C[C@@H]1OCCc2ccccc21)C(=O)Cc1cscn1.
What is the InChIKey of N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide?
The InChIKey is RYNCOGZQPHRLNI-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H18N2O2S/c1-18(16(19)8-13-10-21-11-17-13)9-15-14-5-3-2-4-12(14)6-7-20-15/h2-5,10-11,15H,6-9H2,1H3/t15-/m0/s1.
What are the key properties of N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide?
N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide has a molecular weight of 302.40 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R)-3,4-dihydro-1H-isochromen-1-yl]methyl]-N-methyl-2-(1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 164630900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).