About 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide
2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide (PubChem CID 164631110) has the molecular formula C12H15F2N3O3
and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 164631110 |
| Molecular Formula | C12H15F2N3O3 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide |
| SMILES | NC(=O)c1coc(CNC(=O)[C@H]2CCCC(F)(F)C2)n1 |
| InChI | InChI=1S/C12H15F2N3O3/c13-12(14)3-1-2-7(4-12)11(19)16-5-9-17-8(6-20-9)10(15)18/h6-7H,1-5H2,(H2,15,18)(H,16,19)/t7-/m0/s1 |
| InChIKey | SUPAMUYGVLOWPS-ZETCQYMHSA-N |
| XLogP | 1.22 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide (CID 164631110) is 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide is NC(=O)c1coc(CNC(=O)[C@H]2CCCC(F)(F)C2)n1.
What is the InChIKey of 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide?
The InChIKey is SUPAMUYGVLOWPS-ZETCQYMHSA-N. The full InChI is InChI=1S/C12H15F2N3O3/c13-12(14)3-1-2-7(4-12)11(19)16-5-9-17-8(6-20-9)10(15)18/h6-7H,1-5H2,(H2,15,18)(H,16,19)/t7-/m0/s1.
What are the key properties of 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide?
2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide has a molecular weight of 287.27 g/mol, XLogP of 1.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(1S)-3,3-difluorocyclohexanecarbonyl]amino]methyl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 164631110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).