C18H25N5O — CID 164631127
3-[[[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide (PubChem CID 164631127) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[[[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide.
| Compound Name | 3-[[[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
|---|---|
| PubChem CID | 164631127 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 3-[[[(4S)-2-methyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methyl]-5,6,7,8-tetrahydroindolizine-1-carboxamide |
| SMILES | Cn1cc2c(n1)CCC[C@@H]2NCc1cc(C(N)=O)c2n1CCCC2 |
| InChI | InChI=1S/C18H25N5O/c1-22-11-14-15(5-4-6-16(14)21-22)20-10-12-9-13(18(19)24)17-7-2-3-8-23(12)17/h9,11,15,20H,2-8,10H2,1H3,(H2,19,24)/t15-/m0/s1 |
| InChIKey | BELQSAYPWOPGFL-HNNXBMFYSA-N |
| XLogP | 1.82 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |