C13H17F3N4O — CID 164631144
N-[(1S)-1-(4-aminopyrimidin-2-yl)ethyl]-1-(trifluoromethyl)cyclopentane-1-carboxamide (PubChem CID 164631144) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is N-[(1S)-1-(4-aminopyrimidin-2-yl)ethyl]-1-(trifluoromethyl)cyclopentane-1-carboxamide.
| Compound Name | N-[(1S)-1-(4-aminopyrimidin-2-yl)ethyl]-1-(trifluoromethyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 164631144 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[(1S)-1-(4-aminopyrimidin-2-yl)ethyl]-1-(trifluoromethyl)cyclopentane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1(C(F)(F)F)CCCC1)c1nccc(N)n1 |
| InChI | InChI=1S/C13H17F3N4O/c1-8(10-18-7-4-9(17)20-10)19-11(21)12(13(14,15)16)5-2-3-6-12/h4,7-8H,2-3,5-6H2,1H3,(H,19,21)(H2,17,18,20)/t8-/m0/s1 |
| InChIKey | SMISVQGFIXEGGE-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |