About N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide
N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide (PubChem CID 164631292) has the molecular formula C15H24N2O4S
and a molecular weight of 328.43 g/mol. Its IUPAC name is N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide |
| PubChem CID | 164631292 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide |
| SMILES | CC1(C)COC[C@H](CS(=O)(=O)NCCNc2ccccc2)O1 |
| InChI | InChI=1S/C15H24N2O4S/c1-15(2)12-20-10-14(21-15)11-22(18,19)17-9-8-16-13-6-4-3-5-7-13/h3-7,14,16-17H,8-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | JSYSUTSBOSDWPG-CQSZACIVSA-N |
| XLogP | 1.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide?
The IUPAC name of N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide (CID 164631292) is N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide.
What is the SMILES notation for N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide?
The canonical SMILES for N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide is CC1(C)COC[C@H](CS(=O)(=O)NCCNc2ccccc2)O1.
What is the InChIKey of N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide?
The InChIKey is JSYSUTSBOSDWPG-CQSZACIVSA-N. The full InChI is InChI=1S/C15H24N2O4S/c1-15(2)12-20-10-14(21-15)11-22(18,19)17-9-8-16-13-6-4-3-5-7-13/h3-7,14,16-17H,8-12H2,1-2H3/t14-/m1/s1.
What are the key properties of N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide?
N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide has a molecular weight of 328.43 g/mol, XLogP of 1.21, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-anilinoethyl)-1-[(2R)-6,6-dimethyl-1,4-dioxan-2-yl]methanesulfonamide is sourced from PubChem (CID 164631292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).