C16H19NO3 — CID 164631299
3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-ethyl-2,5-dihydropyrrol-1-yl]propan-1-one (PubChem CID 164631299) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-ethyl-2,5-dihydropyrrol-1-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-ethyl-2,5-dihydropyrrol-1-yl]propan-1-one |
|---|---|
| PubChem CID | 164631299 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[(2S)-2-ethyl-2,5-dihydropyrrol-1-yl]propan-1-one |
| SMILES | CC[C@H]1C=CCN1C(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19NO3/c1-2-13-4-3-9-17(13)16(18)8-6-12-5-7-14-15(10-12)20-11-19-14/h3-5,7,10,13H,2,6,8-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | IUCPBNUCDPDSMB-ZDUSSCGKSA-N |
| XLogP | 2.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|