C17H24N6O2S — CID 164631304
(4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 164631304) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is (4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 164631304 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (4aR,7aS)-4-(1H-imidazol-2-ylmethyl)-1-[(1-prop-2-enylpyrazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | C=CCn1cc(CN2CCN(Cc3ncc[nH]3)[C@H]3CS(=O)(=O)C[C@H]32)cn1 |
| InChI | InChI=1S/C17H24N6O2S/c1-2-5-23-10-14(8-20-23)9-21-6-7-22(11-17-18-3-4-19-17)16-13-26(24,25)12-15(16)21/h2-4,8,10,15-16H,1,5-7,9,11-13H2,(H,18,19)/t15-,16+/m1/s1 |
| InChIKey | RBJCHERAORDLMC-CVEARBPZSA-N |
| XLogP | 0.28 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|