About 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine
7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine (PubChem CID 164631337) has the molecular formula C15H19N3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine |
| PubChem CID | 164631337 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine |
| SMILES | c1cc(N2CC[C@@]3(CCCNC3)C2)c2sccc2n1 |
| InChI | InChI=1S/C15H19N3S/c1-4-15(10-16-6-1)5-8-18(11-15)13-2-7-17-12-3-9-19-14(12)13/h2-3,7,9,16H,1,4-6,8,10-11H2/t15-/m1/s1 |
| InChIKey | BBEKZLISGDINJL-OAHLLOKOSA-N |
| XLogP | 2.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine?
The IUPAC name of 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine (CID 164631337) is 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine.
What is the SMILES notation for 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine?
The canonical SMILES for 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine is c1cc(N2CC[C@@]3(CCCNC3)C2)c2sccc2n1.
What is the InChIKey of 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine?
The InChIKey is BBEKZLISGDINJL-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H19N3S/c1-4-15(10-16-6-1)5-8-18(11-15)13-2-7-17-12-3-9-19-14(12)13/h2-3,7,9,16H,1,4-6,8,10-11H2/t15-/m1/s1.
What are the key properties of 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine?
7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine has a molecular weight of 273.40 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5R)-2,9-diazaspiro[4.5]decan-2-yl]thieno[3,2-b]pyridine is sourced from PubChem (CID 164631337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).