C15H24N4O3 — CID 164631378
[(9aR)-8-(6-ethoxy-2-methylpyrimidin-4-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol (PubChem CID 164631378) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is [(9aR)-8-(6-ethoxy-2-methylpyrimidin-4-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol.
| Compound Name | [(9aR)-8-(6-ethoxy-2-methylpyrimidin-4-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
|---|---|
| PubChem CID | 164631378 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [(9aR)-8-(6-ethoxy-2-methylpyrimidin-4-yl)-1,3,4,6,7,9-hexahydropyrazino[2,1-c][1,4]oxazin-9a-yl]methanol |
| SMILES | CCOc1cc(N2CCN3CCOC[C@]3(CO)C2)nc(C)n1 |
| InChI | InChI=1S/C15H24N4O3/c1-3-22-14-8-13(16-12(2)17-14)18-4-5-19-6-7-21-11-15(19,9-18)10-20/h8,20H,3-7,9-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | VXQPOXDQKWRFGA-OAHLLOKOSA-N |
| XLogP | 0.07 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |