About tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate
tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate (PubChem CID 164631395) has the molecular formula C18H28N4O3
and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate |
| PubChem CID | 164631395 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC=C(C)C(=O)N1C[C@H](NC(=O)OC(C)(C)C)[C@@H](c2cnn(C)c2)C1 |
| InChI | InChI=1S/C18H28N4O3/c1-7-12(2)16(23)22-10-14(13-8-19-21(6)9-13)15(11-22)20-17(24)25-18(3,4)5/h7-9,14-15H,10-11H2,1-6H3,(H,20,24)/t14-,15+/m1/s1 |
| InChIKey | WDEPMGSOTSEWGM-CABCVRRESA-N |
| XLogP | 2.21 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate (CID 164631395) is tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate is CC=C(C)C(=O)N1C[C@H](NC(=O)OC(C)(C)C)[C@@H](c2cnn(C)c2)C1.
What is the InChIKey of tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate?
The InChIKey is WDEPMGSOTSEWGM-CABCVRRESA-N. The full InChI is InChI=1S/C18H28N4O3/c1-7-12(2)16(23)22-10-14(13-8-19-21(6)9-13)15(11-22)20-17(24)25-18(3,4)5/h7-9,14-15H,10-11H2,1-6H3,(H,20,24)/t14-,15+/m1/s1.
What are the key properties of tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate?
tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate has a molecular weight of 348.45 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3R,4S)-1-(2-methylbut-2-enoyl)-4-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]carbamate is sourced from PubChem (CID 164631395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).