About [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone
[(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone (PubChem CID 164631466) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone |
| PubChem CID | 164631466 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CC(C)(C)[C@@H]2C2CC2)nn1C |
| InChI | InChI=1S/C16H25N3O/c1-10(2)13-8-12(17-18(13)5)15(20)19-9-16(3,4)14(19)11-6-7-11/h8,10-11,14H,6-7,9H2,1-5H3/t14-/m0/s1 |
| InChIKey | JPIVFDSTLYGZII-AWEZNQCLSA-N |
| XLogP | 2.80 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone?
The IUPAC name of [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone (CID 164631466) is [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone.
What is the SMILES notation for [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone?
The canonical SMILES for [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone is CC(C)c1cc(C(=O)N2CC(C)(C)[C@@H]2C2CC2)nn1C.
What is the InChIKey of [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone?
The InChIKey is JPIVFDSTLYGZII-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H25N3O/c1-10(2)13-8-12(17-18(13)5)15(20)19-9-16(3,4)14(19)11-6-7-11/h8,10-11,14H,6-7,9H2,1-5H3/t14-/m0/s1.
What are the key properties of [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone?
[(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone has a molecular weight of 275.40 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-cyclopropyl-3,3-dimethylazetidin-1-yl]-(1-methyl-5-propan-2-ylpyrazol-3-yl)methanone is sourced from PubChem (CID 164631466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).