About (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine
(2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine (PubChem CID 164631854) has the molecular formula C15H18FN3S
and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine.
Molecular Properties
| Compound Name | (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine |
| PubChem CID | 164631854 |
| Molecular Formula | C15H18FN3S |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine |
| SMILES | C[C@@H](Cc1ccccc1F)NCc1nnc(C2CC2)s1 |
| InChI | InChI=1S/C15H18FN3S/c1-10(8-12-4-2-3-5-13(12)16)17-9-14-18-19-15(20-14)11-6-7-11/h2-5,10-11,17H,6-9H2,1H3/t10-/m0/s1 |
| InChIKey | QMAMYGPMDMUPDV-JTQLQIEISA-N |
| XLogP | 3.28 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine?
The IUPAC name of (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine (CID 164631854) is (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine.
What is the SMILES notation for (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine?
The canonical SMILES for (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine is C[C@@H](Cc1ccccc1F)NCc1nnc(C2CC2)s1.
What is the InChIKey of (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine?
The InChIKey is QMAMYGPMDMUPDV-JTQLQIEISA-N. The full InChI is InChI=1S/C15H18FN3S/c1-10(8-12-4-2-3-5-13(12)16)17-9-14-18-19-15(20-14)11-6-7-11/h2-5,10-11,17H,6-9H2,1H3/t10-/m0/s1.
What are the key properties of (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine?
(2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine has a molecular weight of 291.39 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-1-(2-fluorophenyl)propan-2-amine is sourced from PubChem (CID 164631854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).