About (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol
(4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol (PubChem CID 164632139) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol.
Molecular Properties
| Compound Name | (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol |
| PubChem CID | 164632139 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol |
| SMILES | Cc1ccnn1CCN1CC[C@H](O)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25N3O/c1-12-4-6-15-17(12)9-8-16-7-5-13(18)10-14(2,3)11-16/h4,6,13,18H,5,7-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | WCXNUSDZAOPYJS-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol?
The IUPAC name of (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol (CID 164632139) is (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol.
What is the SMILES notation for (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol?
The canonical SMILES for (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol is Cc1ccnn1CCN1CC[C@H](O)CC(C)(C)C1.
What is the InChIKey of (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol?
The InChIKey is WCXNUSDZAOPYJS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H25N3O/c1-12-4-6-15-17(12)9-8-16-7-5-13(18)10-14(2,3)11-16/h4,6,13,18H,5,7-11H2,1-3H3/t13-/m0/s1.
What are the key properties of (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol?
(4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol has a molecular weight of 251.37 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6,6-dimethyl-1-[2-(5-methylpyrazol-1-yl)ethyl]azepan-4-ol is sourced from PubChem (CID 164632139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).