About [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea
[(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea (PubChem CID 164632168) has the molecular formula C11H12F2N2O
and a molecular weight of 226.23 g/mol. Its IUPAC name is [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea.
Molecular Properties
| Compound Name | [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea |
| PubChem CID | 164632168 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea |
| SMILES | C=C(C)[C@H](NC(N)=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12F2N2O/c1-6(2)10(15-11(14)16)7-3-4-8(12)9(13)5-7/h3-5,10H,1H2,2H3,(H3,14,15,16)/t10-/m0/s1 |
| InChIKey | BZAPWYLEJQZWQI-JTQLQIEISA-N |
| XLogP | 2.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea?
The IUPAC name of [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea (CID 164632168) is [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea.
What is the SMILES notation for [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea?
The canonical SMILES for [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea is C=C(C)[C@H](NC(N)=O)c1ccc(F)c(F)c1.
What is the InChIKey of [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea?
The InChIKey is BZAPWYLEJQZWQI-JTQLQIEISA-N. The full InChI is InChI=1S/C11H12F2N2O/c1-6(2)10(15-11(14)16)7-3-4-8(12)9(13)5-7/h3-5,10H,1H2,2H3,(H3,14,15,16)/t10-/m0/s1.
What are the key properties of [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea?
[(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea has a molecular weight of 226.23 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-(3,4-difluorophenyl)-2-methylprop-2-enyl]urea is sourced from PubChem (CID 164632168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).