About [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone
[(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone (PubChem CID 164632173) has the molecular formula C19H27NO3
and a molecular weight of 317.43 g/mol. Its IUPAC name is [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone.
Molecular Properties
| Compound Name | [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone |
| PubChem CID | 164632173 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone |
| SMILES | COCC1(C(=O)N2CCO[C@H](c3ccc(C)cc3C)C2)CCC1 |
| InChI | InChI=1S/C19H27NO3/c1-14-5-6-16(15(2)11-14)17-12-20(9-10-23-17)18(21)19(13-22-3)7-4-8-19/h5-6,11,17H,4,7-10,12-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | UQKNVDAIZWHBRA-KRWDZBQOSA-N |
| XLogP | 3.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone?
The IUPAC name of [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone (CID 164632173) is [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone.
What is the SMILES notation for [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone?
The canonical SMILES for [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone is COCC1(C(=O)N2CCO[C@H](c3ccc(C)cc3C)C2)CCC1.
What is the InChIKey of [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone?
The InChIKey is UQKNVDAIZWHBRA-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H27NO3/c1-14-5-6-16(15(2)11-14)17-12-20(9-10-23-17)18(21)19(13-22-3)7-4-8-19/h5-6,11,17H,4,7-10,12-13H2,1-3H3/t17-/m0/s1.
What are the key properties of [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone?
[(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone has a molecular weight of 317.43 g/mol, XLogP of 3.02, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-(2,4-dimethylphenyl)morpholin-4-yl]-[1-(methoxymethyl)cyclobutyl]methanone is sourced from PubChem (CID 164632173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).