C15H21F3N6 — CID 164632197
(1R)-N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine (PubChem CID 164632197) has the molecular formula C15H21F3N6 and a molecular weight of 342.37 g/mol. Its IUPAC name is (1R)-N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine.
| Compound Name | (1R)-N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 164632197 |
| Molecular Formula | C15H21F3N6 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1R)-N-[(5-cyclopropyl-2-methyl-1,2,4-triazol-3-yl)methyl]-2,2,2-trifluoro-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)c(C)c1[C@@H](NCc1nc(C2CC2)nn1C)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N6/c1-8-12(9(2)23(3)21-8)13(15(16,17)18)19-7-11-20-14(10-5-6-10)22-24(11)4/h10,13,19H,5-7H2,1-4H3/t13-/m1/s1 |
| InChIKey | IPDASOKUYBBJRR-CYBMUJFWSA-N |
| XLogP | 2.44 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |