About N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide
N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide (PubChem CID 164632276) has the molecular formula C15H19N3OS
and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide |
| PubChem CID | 164632276 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@@H](C)c2ccccc2N(C)C)ns1 |
| InChI | InChI=1S/C15H19N3OS/c1-10-9-13(17-20-10)15(19)16-11(2)12-7-5-6-8-14(12)18(3)4/h5-9,11H,1-4H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | HLOQMRXJMAZSMU-NSHDSACASA-N |
| XLogP | 3.01 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide?
The IUPAC name of N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide (CID 164632276) is N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide.
What is the SMILES notation for N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide?
The canonical SMILES for N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide is Cc1cc(C(=O)N[C@@H](C)c2ccccc2N(C)C)ns1.
What is the InChIKey of N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide?
The InChIKey is HLOQMRXJMAZSMU-NSHDSACASA-N. The full InChI is InChI=1S/C15H19N3OS/c1-10-9-13(17-20-10)15(19)16-11(2)12-7-5-6-8-14(12)18(3)4/h5-9,11H,1-4H3,(H,16,19)/t11-/m0/s1.
What are the key properties of N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide?
N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide has a molecular weight of 289.40 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-[2-(dimethylamino)phenyl]ethyl]-5-methyl-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 164632276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).