About (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine
(4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine (PubChem CID 164632300) has the molecular formula C14H22N2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine.
Molecular Properties
| Compound Name | (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine |
| PubChem CID | 164632300 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine |
| SMILES | c1nc(CN[C@H]2CCCC23CCCCC3)cs1 |
| InChI | InChI=1S/C14H22N2S/c1-2-6-14(7-3-1)8-4-5-13(14)15-9-12-10-17-11-16-12/h10-11,13,15H,1-9H2/t13-/m0/s1 |
| InChIKey | FYEGHVRNRACUNU-ZDUSSCGKSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine?
The IUPAC name of (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine (CID 164632300) is (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine.
What is the SMILES notation for (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine?
The canonical SMILES for (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine is c1nc(CN[C@H]2CCCC23CCCCC3)cs1.
What is the InChIKey of (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine?
The InChIKey is FYEGHVRNRACUNU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H22N2S/c1-2-6-14(7-3-1)8-4-5-13(14)15-9-12-10-17-11-16-12/h10-11,13,15H,1-9H2/t13-/m0/s1.
What are the key properties of (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine?
(4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine has a molecular weight of 250.41 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-N-(1,3-thiazol-4-ylmethyl)spiro[4.5]decan-4-amine is sourced from PubChem (CID 164632300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).