C18H23N3O4 — CID 164632302
methyl (7S)-3-(3-methoxy-4-propoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate (PubChem CID 164632302) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl (7S)-3-(3-methoxy-4-propoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate.
| Compound Name | methyl (7S)-3-(3-methoxy-4-propoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 164632302 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl (7S)-3-(3-methoxy-4-propoxyphenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine-7-carboxylate |
| SMILES | CCCOc1ccc(-c2nnc3n2CC[C@H](C(=O)OC)C3)cc1OC |
| InChI | InChI=1S/C18H23N3O4/c1-4-9-25-14-6-5-12(10-15(14)23-2)17-20-19-16-11-13(18(22)24-3)7-8-21(16)17/h5-6,10,13H,4,7-9,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | OMPPSUBQBXRITJ-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |