About (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol
(3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol (PubChem CID 164632315) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol.
Molecular Properties
| Compound Name | (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol |
| PubChem CID | 164632315 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol |
| SMILES | Cc1cc(C)nc(CN(C)c2nccc(N3CCC[C@H](O)C3)n2)c1 |
| InChI | InChI=1S/C18H25N5O/c1-13-9-14(2)20-15(10-13)11-22(3)18-19-7-6-17(21-18)23-8-4-5-16(24)12-23/h6-7,9-10,16,24H,4-5,8,11-12H2,1-3H3/t16-/m0/s1 |
| InChIKey | SRHCZCZPKMWRHD-INIZCTEOSA-N |
| XLogP | 2.09 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol?
The IUPAC name of (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol (CID 164632315) is (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol.
What is the SMILES notation for (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol?
The canonical SMILES for (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol is Cc1cc(C)nc(CN(C)c2nccc(N3CCC[C@H](O)C3)n2)c1.
What is the InChIKey of (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol?
The InChIKey is SRHCZCZPKMWRHD-INIZCTEOSA-N. The full InChI is InChI=1S/C18H25N5O/c1-13-9-14(2)20-15(10-13)11-22(3)18-19-7-6-17(21-18)23-8-4-5-16(24)12-23/h6-7,9-10,16,24H,4-5,8,11-12H2,1-3H3/t16-/m0/s1.
What are the key properties of (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol?
(3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol has a molecular weight of 327.43 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[2-[(4,6-dimethyl-2-pyridinyl)methyl-methylamino]pyrimidin-4-yl]piperidin-3-ol is sourced from PubChem (CID 164632315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).