About 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea
3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea (PubChem CID 164632331) has the molecular formula C17H26N4O
and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea.
Molecular Properties
| Compound Name | 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea |
| PubChem CID | 164632331 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea |
| SMILES | CN(CCc1cnccn1)C(=O)N[C@H]1CCC[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C17H26N4O/c1-21(10-7-16-12-18-8-9-19-16)17(22)20-15-4-2-3-14(11-15)13-5-6-13/h8-9,12-15H,2-7,10-11H2,1H3,(H,20,22)/t14-,15+/m1/s1 |
| InChIKey | BTIOUZLGSJRHIY-CABCVRRESA-N |
| XLogP | 2.63 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea?
The IUPAC name of 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea (CID 164632331) is 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea.
What is the SMILES notation for 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea?
The canonical SMILES for 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea is CN(CCc1cnccn1)C(=O)N[C@H]1CCC[C@@H](C2CC2)C1.
What is the InChIKey of 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea?
The InChIKey is BTIOUZLGSJRHIY-CABCVRRESA-N. The full InChI is InChI=1S/C17H26N4O/c1-21(10-7-16-12-18-8-9-19-16)17(22)20-15-4-2-3-14(11-15)13-5-6-13/h8-9,12-15H,2-7,10-11H2,1H3,(H,20,22)/t14-,15+/m1/s1.
What are the key properties of 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea?
3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea has a molecular weight of 302.42 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,3R)-3-cyclopropylcyclohexyl]-1-methyl-1-(2-pyrazin-2-ylethyl)urea is sourced from PubChem (CID 164632331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).