C21H24N4O2 — CID 164632574
(1S,9R)-5-amino-3-[3-(2-hydroxyethoxy)phenyl]-13-methyl-6,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile (PubChem CID 164632574) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (1S,9R)-5-amino-3-[3-(2-hydroxyethoxy)phenyl]-13-methyl-6,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile.
| Compound Name | (1S,9R)-5-amino-3-[3-(2-hydroxyethoxy)phenyl]-13-methyl-6,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile |
|---|---|
| PubChem CID | 164632574 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (1S,9R)-5-amino-3-[3-(2-hydroxyethoxy)phenyl]-13-methyl-6,13-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carbonitrile |
| SMILES | CN1[C@@H]2CCC[C@H]1c1c(nc(N)c(C#N)c1-c1cccc(OCCO)c1)C2 |
| InChI | InChI=1S/C21H24N4O2/c1-25-14-5-3-7-18(25)20-17(11-14)24-21(23)16(12-22)19(20)13-4-2-6-15(10-13)27-9-8-26/h2,4,6,10,14,18,26H,3,5,7-9,11H2,1H3,(H2,23,24)/t14-,18+/m1/s1 |
| InChIKey | JSNJXZMCHXAXME-KDOFPFPSSA-N |
| XLogP | 2.66 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |