C17H19N3O2S — CID 164632682
(3S)-3-benzyl-4-(5-methyl-1,2-thiazole-3-carbonyl)-1,4-diazepan-2-one (PubChem CID 164632682) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (3S)-3-benzyl-4-(5-methyl-1,2-thiazole-3-carbonyl)-1,4-diazepan-2-one.
| Compound Name | (3S)-3-benzyl-4-(5-methyl-1,2-thiazole-3-carbonyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 164632682 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (3S)-3-benzyl-4-(5-methyl-1,2-thiazole-3-carbonyl)-1,4-diazepan-2-one |
| SMILES | Cc1cc(C(=O)N2CCCNC(=O)[C@@H]2Cc2ccccc2)ns1 |
| InChI | InChI=1S/C17H19N3O2S/c1-12-10-14(19-23-12)17(22)20-9-5-8-18-16(21)15(20)11-13-6-3-2-4-7-13/h2-4,6-7,10,15H,5,8-9,11H2,1H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | BPZIHIMVOXGDFV-HNNXBMFYSA-N |
| XLogP | 2.02 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |