About 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine
9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine (PubChem CID 164632728) has the molecular formula C17H21N7O
and a molecular weight of 339.40 g/mol. Its IUPAC name is 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine.
Molecular Properties
| Compound Name | 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine |
| PubChem CID | 164632728 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine |
| SMILES | Cn1cc([C@H]2OCC[C@@H]2CNc2ncnc3c2ncn3C2CC2)cn1 |
| InChI | InChI=1S/C17H21N7O/c1-23-8-12(7-22-23)15-11(4-5-25-15)6-18-16-14-17(20-9-19-16)24(10-21-14)13-2-3-13/h7-11,13,15H,2-6H2,1H3,(H,18,19,20)/t11-,15+/m1/s1 |
| InChIKey | BMEGTIYIGFWPCB-ABAIWWIYSA-N |
| XLogP | 2.08 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine?
The IUPAC name of 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine (CID 164632728) is 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine.
What is the SMILES notation for 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine?
The canonical SMILES for 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine is Cn1cc([C@H]2OCC[C@@H]2CNc2ncnc3c2ncn3C2CC2)cn1.
What is the InChIKey of 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine?
The InChIKey is BMEGTIYIGFWPCB-ABAIWWIYSA-N. The full InChI is InChI=1S/C17H21N7O/c1-23-8-12(7-22-23)15-11(4-5-25-15)6-18-16-14-17(20-9-19-16)24(10-21-14)13-2-3-13/h7-11,13,15H,2-6H2,1H3,(H,18,19,20)/t11-,15+/m1/s1.
What are the key properties of 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine?
9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine has a molecular weight of 339.40 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclopropyl-N-[[(2S,3R)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]purin-6-amine is sourced from PubChem (CID 164632728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).